C21H17F6NO — CID 52937029
(1E,4E)-1-[3,5-bis(trifluoromethyl)phenyl]-5-[4-(dimethylamino)phenyl]penta-1,4-dien-3-one (PubChem CID 52937029) has the molecular formula C21H17F6NO and a molecular weight of 413.36 g/mol. Its IUPAC name is (1E,4E)-1-[3,5-bis(trifluoromethyl)phenyl]-5-[4-(dimethylamino)phenyl]penta-1,4-dien-3-one.
| Compound Name | (1E,4E)-1-[3,5-bis(trifluoromethyl)phenyl]-5-[4-(dimethylamino)phenyl]penta-1,4-dien-3-one |
|---|---|
| PubChem CID | 52937029 |
| Molecular Formula | C21H17F6NO |
| Molecular Weight | 413.36 g/mol |
| Exact Mass | 413.12 |
| IUPAC Name | (1E,4E)-1-[3,5-bis(trifluoromethyl)phenyl]-5-[4-(dimethylamino)phenyl]penta-1,4-dien-3-one |
| SMILES | CN(C)c1ccc(/C=C/C(=O)/C=C/c2cc(C(F)(F)F)cc(C(F)(F)F)c2)cc1 |
| InChI | InChI=1S/C21H17F6NO/c1-28(2)18-7-3-14(4-8-18)5-9-19(29)10-6-15-11-16(20(22,23)24)13-17(12-15)21(25,26)27/h3-13H,1-2H3/b9-5+,10-6+ |
| InChIKey | ZWEOZTYSOAUXJX-NXZHAISVSA-N |
| XLogP | 6.09 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 413.36 |
| LogP ≤ 5 | 6.09 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'anil_di_alk_B(251)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|