C21H23NO3 — CID 52937031
(1E,4E)-1-(3,5-dimethoxyphenyl)-5-[4-(dimethylamino)phenyl]penta-1,4-dien-3-one (PubChem CID 52937031) has the molecular formula C21H23NO3 and a molecular weight of 337.42 g/mol. Its IUPAC name is (1E,4E)-1-(3,5-dimethoxyphenyl)-5-[4-(dimethylamino)phenyl]penta-1,4-dien-3-one.
| Compound Name | (1E,4E)-1-(3,5-dimethoxyphenyl)-5-[4-(dimethylamino)phenyl]penta-1,4-dien-3-one |
|---|---|
| PubChem CID | 52937031 |
| Molecular Formula | C21H23NO3 |
| Molecular Weight | 337.42 g/mol |
| Exact Mass | 337.17 |
| IUPAC Name | (1E,4E)-1-(3,5-dimethoxyphenyl)-5-[4-(dimethylamino)phenyl]penta-1,4-dien-3-one |
| SMILES | COc1cc(/C=C/C(=O)/C=C/c2ccc(N(C)C)cc2)cc(OC)c1 |
| InChI | InChI=1S/C21H23NO3/c1-22(2)18-9-5-16(6-10-18)7-11-19(23)12-8-17-13-20(24-3)15-21(14-17)25-4/h5-15H,1-4H3/b11-7+,12-8+ |
| InChIKey | VCPRQZDIBBBKQB-MKICQXMISA-N |
| XLogP | 4.07 |
| TPSA | 38.77 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 337.42 |
| LogP ≤ 5 | 4.07 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'anil_di_alk_B(251)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|