C27H34O — CID 52937033
(3aR,6aS)-5-hexyl-6-phenyl-6a-phenylmethoxy-2,3,3a,4-tetrahydro-1H-pentalene (PubChem CID 52937033) has the molecular formula C27H34O and a molecular weight of 374.57 g/mol. Its IUPAC name is (3aR,6aS)-5-hexyl-6-phenyl-6a-phenylmethoxy-2,3,3a,4-tetrahydro-1H-pentalene.
| Compound Name | (3aR,6aS)-5-hexyl-6-phenyl-6a-phenylmethoxy-2,3,3a,4-tetrahydro-1H-pentalene |
|---|---|
| PubChem CID | 52937033 |
| Molecular Formula | C27H34O |
| Molecular Weight | 374.57 g/mol |
| Exact Mass | 374.26 |
| IUPAC Name | (3aR,6aS)-5-hexyl-6-phenyl-6a-phenylmethoxy-2,3,3a,4-tetrahydro-1H-pentalene |
| SMILES | CCCCCCC1=C(c2ccccc2)[C@]2(OCc3ccccc3)CCC[C@@H]2C1 |
| InChI | InChI=1S/C27H34O/c1-2-3-4-9-17-24-20-25-18-12-19-27(25,26(24)23-15-10-6-11-16-23)28-21-22-13-7-5-8-14-22/h5-8,10-11,13-16,25H,2-4,9,12,17-21H2,1H3/t25-,27+/m1/s1 |
| InChIKey | BIGWEXCZUZTNDX-VPUSJEBWSA-N |
| XLogP | 7.57 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 374.57 |
| LogP ≤ 5 | 7.57 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|