C30H38 — CID 52937038
(3aR,6aR)-6a-[1-(4-ethylphenyl)ethenyl]-5-hexyl-6-phenyl-2,3,3a,4-tetrahydro-1H-pentalene (PubChem CID 52937038) has the molecular formula C30H38 and a molecular weight of 398.63 g/mol. Its IUPAC name is (3aR,6aR)-6a-[1-(4-ethylphenyl)ethenyl]-5-hexyl-6-phenyl-2,3,3a,4-tetrahydro-1H-pentalene.
| Compound Name | (3aR,6aR)-6a-[1-(4-ethylphenyl)ethenyl]-5-hexyl-6-phenyl-2,3,3a,4-tetrahydro-1H-pentalene |
|---|---|
| PubChem CID | 52937038 |
| Molecular Formula | C30H38 |
| Molecular Weight | 398.63 g/mol |
| Exact Mass | 398.30 |
| IUPAC Name | (3aR,6aR)-6a-[1-(4-ethylphenyl)ethenyl]-5-hexyl-6-phenyl-2,3,3a,4-tetrahydro-1H-pentalene |
| SMILES | C=C(c1ccc(CC)cc1)[C@@]12CCC[C@@H]1CC(CCCCCC)=C2c1ccccc1 |
| InChI | InChI=1S/C30H38/c1-4-6-7-9-15-27-22-28-16-12-21-30(28,29(27)26-13-10-8-11-14-26)23(3)25-19-17-24(5-2)18-20-25/h8,10-11,13-14,17-20,28H,3-7,9,12,15-16,21-22H2,1-2H3/t28-,30+/m1/s1 |
| InChIKey | GUDDJXMJUBIWPD-DGPALRBDSA-N |
| XLogP | 8.88 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 9 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 398.63 |
| LogP ≤ 5 | 8.88 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|