C20H28O — CID 52937074
(1R,6S)-5,5-dimethyl-10-propan-2-yl-14-oxatetracyclo[7.6.1.01,6.013,16]hexadeca-9,11,13(16)-triene (PubChem CID 52937074) has the molecular formula C20H28O and a molecular weight of 284.44 g/mol. Its IUPAC name is (1R,6S)-5,5-dimethyl-10-propan-2-yl-14-oxatetracyclo[7.6.1.01,6.013,16]hexadeca-9,11,13(16)-triene.
| Compound Name | (1R,6S)-5,5-dimethyl-10-propan-2-yl-14-oxatetracyclo[7.6.1.01,6.013,16]hexadeca-9,11,13(16)-triene |
|---|---|
| PubChem CID | 52937074 |
| Molecular Formula | C20H28O |
| Molecular Weight | 284.44 g/mol |
| Exact Mass | 284.21 |
| IUPAC Name | (1R,6S)-5,5-dimethyl-10-propan-2-yl-14-oxatetracyclo[7.6.1.01,6.013,16]hexadeca-9,11,13(16)-triene |
| SMILES | CC(C)c1ccc2c3c1CC[C@H]1C(C)(C)CCC[C@]31CO2 |
| InChI | InChI=1S/C20H28O/c1-13(2)14-6-8-16-18-15(14)7-9-17-19(3,4)10-5-11-20(17,18)12-21-16/h6,8,13,17H,5,7,9-12H2,1-4H3/t17-,20+/m0/s1 |
| InChIKey | XNNWEJWWBGSSMR-FXAWDEMLSA-N |
| XLogP | 5.21 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 284.44 |
| LogP ≤ 5 | 5.21 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |