C23H19F6NO4 — CID 52937215
(4E)-5-[2,4-bis(trifluoromethyl)phenyl]-4-[hydroxy-(4-methylphenyl)methylidene]-1-(2-hydroxypropyl)pyrrolidine-2,3-dione (PubChem CID 52937215) has the molecular formula C23H19F6NO4 and a molecular weight of 487.40 g/mol. Its IUPAC name is (4E)-5-[2,4-bis(trifluoromethyl)phenyl]-4-[hydroxy-(4-methylphenyl)methylidene]-1-(2-hydroxypropyl)pyrrolidine-2,3-dione.
| Compound Name | (4E)-5-[2,4-bis(trifluoromethyl)phenyl]-4-[hydroxy-(4-methylphenyl)methylidene]-1-(2-hydroxypropyl)pyrrolidine-2,3-dione |
|---|---|
| PubChem CID | 52937215 |
| Molecular Formula | C23H19F6NO4 |
| Molecular Weight | 487.40 g/mol |
| Exact Mass | 487.12 |
| IUPAC Name | (4E)-5-[2,4-bis(trifluoromethyl)phenyl]-4-[hydroxy-(4-methylphenyl)methylidene]-1-(2-hydroxypropyl)pyrrolidine-2,3-dione |
| SMILES | Cc1ccc(/C(O)=C2\C(=O)C(=O)N(CC(C)O)C2c2ccc(C(F)(F)F)cc2C(F)(F)F)cc1 |
| InChI | InChI=1S/C23H19F6NO4/c1-11-3-5-13(6-4-11)19(32)17-18(30(10-12(2)31)21(34)20(17)33)15-8-7-14(22(24,25)26)9-16(15)23(27,28)29/h3-9,12,18,31-32H,10H2,1-2H3/b19-17+ |
| InChIKey | KQUOKUMZGCVGJW-HTXNQAPBSA-N |
| XLogP | 4.84 |
| TPSA | 77.84 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 487.40 |
| LogP ≤ 5 | 4.84 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|