About (1E,4E)-1-[4-(dimethylamino)phenyl]-5-(6-iodo-3-pyridinyl)penta-1,4-dien-3-one
(1E,4E)-1-[4-(dimethylamino)phenyl]-5-(6-iodo-3-pyridinyl)penta-1,4-dien-3-one (PubChem CID 52937235) has the molecular formula C18H17IN2O
and a molecular weight of 404.25 g/mol. Its IUPAC name is (1E,4E)-1-[4-(dimethylamino)phenyl]-5-(6-iodo-3-pyridinyl)penta-1,4-dien-3-one.
Molecular Properties
| Compound Name | (1E,4E)-1-[4-(dimethylamino)phenyl]-5-(6-iodo-3-pyridinyl)penta-1,4-dien-3-one |
| PubChem CID | 52937235 |
| Molecular Formula | C18H17IN2O |
| Molecular Weight | 404.25 g/mol |
| Exact Mass | 404.04 |
| IUPAC Name | (1E,4E)-1-[4-(dimethylamino)phenyl]-5-(6-iodo-3-pyridinyl)penta-1,4-dien-3-one |
| SMILES | CN(C)c1ccc(/C=C/C(=O)/C=C/c2ccc(I)nc2)cc1 |
| InChI | InChI=1S/C18H17IN2O/c1-21(2)16-8-3-14(4-9-16)5-10-17(22)11-6-15-7-12-18(19)20-13-15/h3-13H,1-2H3/b10-5+,11-6+ |
| InChIKey | OPLXTZIAYIRERS-YOYBCKCWSA-N |
| XLogP | 4.05 |
| TPSA | 33.20 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 404.25 |
| LogP ≤ 5 | 4.05 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'anil_di_alk_B(251)', 'substructure': 'N/A'}, {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|
Analyze (1E,4E)-1-[4-(dimethylamino)phenyl]-5-(6-iodo-3-pyridinyl)penta-1,4-dien-3-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (1E,4E)-1-[4-(dimethylamino)phenyl]-5-(6-iodo-3-pyridinyl)penta-1,4-dien-3-one?
The IUPAC name of (1E,4E)-1-[4-(dimethylamino)phenyl]-5-(6-iodo-3-pyridinyl)penta-1,4-dien-3-one (CID 52937235) is (1E,4E)-1-[4-(dimethylamino)phenyl]-5-(6-iodo-3-pyridinyl)penta-1,4-dien-3-one.
What is the SMILES notation for (1E,4E)-1-[4-(dimethylamino)phenyl]-5-(6-iodo-3-pyridinyl)penta-1,4-dien-3-one?
The canonical SMILES for (1E,4E)-1-[4-(dimethylamino)phenyl]-5-(6-iodo-3-pyridinyl)penta-1,4-dien-3-one is CN(C)c1ccc(/C=C/C(=O)/C=C/c2ccc(I)nc2)cc1.
What is the InChIKey of (1E,4E)-1-[4-(dimethylamino)phenyl]-5-(6-iodo-3-pyridinyl)penta-1,4-dien-3-one?
The InChIKey is OPLXTZIAYIRERS-YOYBCKCWSA-N. The full InChI is InChI=1S/C18H17IN2O/c1-21(2)16-8-3-14(4-9-16)5-10-17(22)11-6-15-7-12-18(19)20-13-15/h3-13H,1-2H3/b10-5+,11-6+.
What are the key properties of (1E,4E)-1-[4-(dimethylamino)phenyl]-5-(6-iodo-3-pyridinyl)penta-1,4-dien-3-one?
(1E,4E)-1-[4-(dimethylamino)phenyl]-5-(6-iodo-3-pyridinyl)penta-1,4-dien-3-one has a molecular weight of 404.25 g/mol, XLogP of 4.05, 5 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for (1E,4E)-1-[4-(dimethylamino)phenyl]-5-(6-iodo-3-pyridinyl)penta-1,4-dien-3-one is sourced from PubChem (CID 52937235), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).