C24H23NO2 — CID 52937342
(1E,4E)-1-[4-(dimethylamino)phenyl]-5-(6-methoxynaphthalen-2-yl)penta-1,4-dien-3-one (PubChem CID 52937342) has the molecular formula C24H23NO2 and a molecular weight of 357.45 g/mol. Its IUPAC name is (1E,4E)-1-[4-(dimethylamino)phenyl]-5-(6-methoxynaphthalen-2-yl)penta-1,4-dien-3-one.
| Compound Name | (1E,4E)-1-[4-(dimethylamino)phenyl]-5-(6-methoxynaphthalen-2-yl)penta-1,4-dien-3-one |
|---|---|
| PubChem CID | 52937342 |
| Molecular Formula | C24H23NO2 |
| Molecular Weight | 357.45 g/mol |
| Exact Mass | 357.17 |
| IUPAC Name | (1E,4E)-1-[4-(dimethylamino)phenyl]-5-(6-methoxynaphthalen-2-yl)penta-1,4-dien-3-one |
| SMILES | COc1ccc2cc(/C=C/C(=O)/C=C/c3ccc(N(C)C)cc3)ccc2c1 |
| InChI | InChI=1S/C24H23NO2/c1-25(2)22-11-5-18(6-12-22)7-13-23(26)14-8-19-4-9-21-17-24(27-3)15-10-20(21)16-19/h4-17H,1-3H3/b13-7+,14-8+ |
| InChIKey | MPPUCJKAXPVGLT-FNCQTZNRSA-N |
| XLogP | 5.21 |
| TPSA | 29.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 357.45 |
| LogP ≤ 5 | 5.21 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'anil_di_alk_B(251)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|