C30H32Si — CID 52937355
[(3aR,6aR)-3-phenyl-3a-(1-phenylethenyl)-4,5,6,6a-tetrahydro-1H-pentalen-2-yl]-dimethyl-phenylsilane (PubChem CID 52937355) has the molecular formula C30H32Si and a molecular weight of 420.67 g/mol. Its IUPAC name is [(3aR,6aR)-3-phenyl-3a-(1-phenylethenyl)-4,5,6,6a-tetrahydro-1H-pentalen-2-yl]-dimethyl-phenylsilane.
| Compound Name | [(3aR,6aR)-3-phenyl-3a-(1-phenylethenyl)-4,5,6,6a-tetrahydro-1H-pentalen-2-yl]-dimethyl-phenylsilane |
|---|---|
| PubChem CID | 52937355 |
| Molecular Formula | C30H32Si |
| Molecular Weight | 420.67 g/mol |
| Exact Mass | 420.23 |
| IUPAC Name | [(3aR,6aR)-3-phenyl-3a-(1-phenylethenyl)-4,5,6,6a-tetrahydro-1H-pentalen-2-yl]-dimethyl-phenylsilane |
| SMILES | C=C(c1ccccc1)[C@@]12CCC[C@@H]1CC([Si](C)(C)c1ccccc1)=C2c1ccccc1 |
| InChI | InChI=1S/C30H32Si/c1-23(24-14-7-4-8-15-24)30-21-13-18-26(30)22-28(29(30)25-16-9-5-10-17-25)31(2,3)27-19-11-6-12-20-27/h4-12,14-17,19-20,26H,1,13,18,21-22H2,2-3H3/t26-,30+/m1/s1 |
| InChIKey | OAJGZGYPDVPEPP-VIZCGCQYSA-N |
| XLogP | 7.50 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 420.67 |
| LogP ≤ 5 | 7.50 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|