C20H32N4O5 — CID 52937609
(1R,2S,4R,5S)-6-[[1-(1-adamantylmethyl)triazol-4-yl]methylamino]cyclohexane-1,2,3,4,5-pentol (PubChem CID 52937609) has the molecular formula C20H32N4O5 and a molecular weight of 408.50 g/mol. Its IUPAC name is (1R,2S,4R,5S)-6-[[1-(1-adamantylmethyl)triazol-4-yl]methylamino]cyclohexane-1,2,3,4,5-pentol.
| Compound Name | (1R,2S,4R,5S)-6-[[1-(1-adamantylmethyl)triazol-4-yl]methylamino]cyclohexane-1,2,3,4,5-pentol |
|---|---|
| PubChem CID | 52937609 |
| Molecular Formula | C20H32N4O5 |
| Molecular Weight | 408.50 g/mol |
| Exact Mass | 408.24 |
| IUPAC Name | (1R,2S,4R,5S)-6-[[1-(1-adamantylmethyl)triazol-4-yl]methylamino]cyclohexane-1,2,3,4,5-pentol |
| SMILES | OC1[C@@H](O)[C@H](O)C(NCc2cn(CC34CC5CC(CC(C5)C3)C4)nn2)[C@H](O)[C@H]1O |
| InChI | InChI=1S/C20H32N4O5/c25-15-14(16(26)18(28)19(29)17(15)27)21-7-13-8-24(23-22-13)9-20-4-10-1-11(5-20)3-12(2-10)6-20/h8,10-12,14-19,21,25-29H,1-7,9H2/t10?,11?,12?,14?,15-,16+,17+,18-,19?,20? |
| InChIKey | WUOWYKPGZRQBCX-RPWWLJJESA-N |
| XLogP | -1.23 |
| TPSA | 143.89 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 408.50 |
| LogP ≤ 5 | -1.23 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 9 |