C30H34N4O — CID 52937680
N-[4-[1,2-diazatricyclo[6.3.1.04,12]dodeca-2,4(12),8,10-tetraen-6-yl(propyl)amino]butyl]-4-phenylbenzamide (PubChem CID 52937680) has the molecular formula C30H34N4O and a molecular weight of 466.63 g/mol. Its IUPAC name is N-[4-[1,2-diazatricyclo[6.3.1.04,12]dodeca-2,4(12),8,10-tetraen-6-yl(propyl)amino]butyl]-4-phenylbenzamide.
| Compound Name | N-[4-[1,2-diazatricyclo[6.3.1.04,12]dodeca-2,4(12),8,10-tetraen-6-yl(propyl)amino]butyl]-4-phenylbenzamide |
|---|---|
| PubChem CID | 52937680 |
| Molecular Formula | C30H34N4O |
| Molecular Weight | 466.63 g/mol |
| Exact Mass | 466.27 |
| IUPAC Name | N-[4-[1,2-diazatricyclo[6.3.1.04,12]dodeca-2,4(12),8,10-tetraen-6-yl(propyl)amino]butyl]-4-phenylbenzamide |
| SMILES | CCCN(CCCCNC(=O)c1ccc(-c2ccccc2)cc1)C1Cc2cccn3ncc(c23)C1 |
| InChI | InChI=1S/C30H34N4O/c1-2-17-33(28-20-26-11-8-19-34-29(26)27(21-28)22-32-34)18-7-6-16-31-30(35)25-14-12-24(13-15-25)23-9-4-3-5-10-23/h3-5,8-15,19,22,28H,2,6-7,16-18,20-21H2,1H3,(H,31,35) |
| InChIKey | LQCUFDIAPSFACZ-UHFFFAOYSA-N |
| XLogP | 5.39 |
| TPSA | 49.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 466.63 |
| LogP ≤ 5 | 5.39 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|