C20H28N2O3 — CID 52937765
1-octyl-3-(2-phenylethyl)-1,3-diazinane-2,4,6-trione (PubChem CID 52937765) has the molecular formula C20H28N2O3 and a molecular weight of 344.45 g/mol. Its IUPAC name is 1-octyl-3-(2-phenylethyl)-1,3-diazinane-2,4,6-trione.
| Compound Name | 1-octyl-3-(2-phenylethyl)-1,3-diazinane-2,4,6-trione |
|---|---|
| PubChem CID | 52937765 |
| Molecular Formula | C20H28N2O3 |
| Molecular Weight | 344.45 g/mol |
| Exact Mass | 344.21 |
| IUPAC Name | 1-octyl-3-(2-phenylethyl)-1,3-diazinane-2,4,6-trione |
| SMILES | CCCCCCCCN1C(=O)CC(=O)N(CCc2ccccc2)C1=O |
| InChI | InChI=1S/C20H28N2O3/c1-2-3-4-5-6-10-14-21-18(23)16-19(24)22(20(21)25)15-13-17-11-8-7-9-12-17/h7-9,11-12H,2-6,10,13-16H2,1H3 |
| InChIKey | MHPSUTWAAXOBNB-UHFFFAOYSA-N |
| XLogP | 3.77 |
| TPSA | 57.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 344.45 |
| LogP ≤ 5 | 3.77 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|