C6H12S4 — CID 529378
4,6-diethyl-1,2,3,5-tetrathiane (PubChem CID 529378) has the molecular formula C6H12S4 and a molecular weight of 212.43 g/mol. Its IUPAC name is 4,6-diethyl-1,2,3,5-tetrathiane.
| Compound Name | 4,6-diethyl-1,2,3,5-tetrathiane |
|---|---|
| PubChem CID | 529378 |
| Molecular Formula | C6H12S4 |
| Molecular Weight | 212.43 g/mol |
| Exact Mass | 211.98 |
| IUPAC Name | 4,6-diethyl-1,2,3,5-tetrathiane |
| SMILES | CCC1SSSC(CC)S1 |
| InChI | InChI=1S/C6H12S4/c1-3-5-7-6(4-2)9-10-8-5/h5-6H,3-4H2,1-2H3 |
| InChIKey | SBTJQRLWWVYRND-UHFFFAOYSA-N |
| XLogP | 4.24 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 212.43 |
| LogP ≤ 5 | 4.24 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'disulphide', 'substructure': 'N/A'} |
|---|