C17H21FN2O4 — CID 52937865
1-[2-(4-fluorophenyl)ethyl]-3-(2-propan-2-yloxyethyl)-1,3-diazinane-2,4,6-trione (PubChem CID 52937865) has the molecular formula C17H21FN2O4 and a molecular weight of 336.36 g/mol. Its IUPAC name is 1-[2-(4-fluorophenyl)ethyl]-3-(2-propan-2-yloxyethyl)-1,3-diazinane-2,4,6-trione.
| Compound Name | 1-[2-(4-fluorophenyl)ethyl]-3-(2-propan-2-yloxyethyl)-1,3-diazinane-2,4,6-trione |
|---|---|
| PubChem CID | 52937865 |
| Molecular Formula | C17H21FN2O4 |
| Molecular Weight | 336.36 g/mol |
| Exact Mass | 336.15 |
| IUPAC Name | 1-[2-(4-fluorophenyl)ethyl]-3-(2-propan-2-yloxyethyl)-1,3-diazinane-2,4,6-trione |
| SMILES | CC(C)OCCN1C(=O)CC(=O)N(CCc2ccc(F)cc2)C1=O |
| InChI | InChI=1S/C17H21FN2O4/c1-12(2)24-10-9-20-16(22)11-15(21)19(17(20)23)8-7-13-3-5-14(18)6-4-13/h3-6,12H,7-11H2,1-2H3 |
| InChIKey | UATUEODDUQSVNY-UHFFFAOYSA-N |
| XLogP | 1.97 |
| TPSA | 66.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 336.36 |
| LogP ≤ 5 | 1.97 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|