C21H17NO5 — CID 52937996
3-(1H-indol-5-yl)-4-(3,4,5-trimethoxyphenyl)cyclobut-3-ene-1,2-dione (PubChem CID 52937996) has the molecular formula C21H17NO5 and a molecular weight of 363.37 g/mol. Its IUPAC name is 3-(1H-indol-5-yl)-4-(3,4,5-trimethoxyphenyl)cyclobut-3-ene-1,2-dione.
| Compound Name | 3-(1H-indol-5-yl)-4-(3,4,5-trimethoxyphenyl)cyclobut-3-ene-1,2-dione |
|---|---|
| PubChem CID | 52937996 |
| Molecular Formula | C21H17NO5 |
| Molecular Weight | 363.37 g/mol |
| Exact Mass | 363.11 |
| IUPAC Name | 3-(1H-indol-5-yl)-4-(3,4,5-trimethoxyphenyl)cyclobut-3-ene-1,2-dione |
| SMILES | COc1cc(-c2c(-c3ccc4[nH]ccc4c3)c(=O)c2=O)cc(OC)c1OC |
| InChI | InChI=1S/C21H17NO5/c1-25-15-9-13(10-16(26-2)21(15)27-3)18-17(19(23)20(18)24)12-4-5-14-11(8-12)6-7-22-14/h4-10,22H,1-3H3 |
| InChIKey | INTLVOCGDBFKDJ-UHFFFAOYSA-N |
| XLogP | 3.12 |
| TPSA | 77.62 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 363.37 |
| LogP ≤ 5 | 3.12 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|