About 5-[[3,5-bis(trifluoromethyl)phenoxy]methyl]cyclohexane-1,3-dione
5-[[3,5-bis(trifluoromethyl)phenoxy]methyl]cyclohexane-1,3-dione (PubChem CID 52938086) has the molecular formula C15H12F6O3
and a molecular weight of 354.25 g/mol. Its IUPAC name is 5-[[3,5-bis(trifluoromethyl)phenoxy]methyl]cyclohexane-1,3-dione.
Molecular Properties
| Compound Name | 5-[[3,5-bis(trifluoromethyl)phenoxy]methyl]cyclohexane-1,3-dione |
| PubChem CID | 52938086 |
| Molecular Formula | C15H12F6O3 |
| Molecular Weight | 354.25 g/mol |
| Exact Mass | 354.07 |
| IUPAC Name | 5-[[3,5-bis(trifluoromethyl)phenoxy]methyl]cyclohexane-1,3-dione |
| SMILES | O=C1CC(=O)CC(COc2cc(C(F)(F)F)cc(C(F)(F)F)c2)C1 |
| InChI | InChI=1S/C15H12F6O3/c16-14(17,18)9-3-10(15(19,20)21)5-13(4-9)24-7-8-1-11(22)6-12(23)2-8/h3-5,8H,1-2,6-7H2 |
| InChIKey | MCGIWMAVEWETEI-UHFFFAOYSA-N |
| XLogP | 4.04 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 354.25 |
| LogP ≤ 5 | 4.04 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|
Analyze 5-[[3,5-bis(trifluoromethyl)phenoxy]methyl]cyclohexane-1,3-dione with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-[[3,5-bis(trifluoromethyl)phenoxy]methyl]cyclohexane-1,3-dione?
The IUPAC name of 5-[[3,5-bis(trifluoromethyl)phenoxy]methyl]cyclohexane-1,3-dione (CID 52938086) is 5-[[3,5-bis(trifluoromethyl)phenoxy]methyl]cyclohexane-1,3-dione.
What is the SMILES notation for 5-[[3,5-bis(trifluoromethyl)phenoxy]methyl]cyclohexane-1,3-dione?
The canonical SMILES for 5-[[3,5-bis(trifluoromethyl)phenoxy]methyl]cyclohexane-1,3-dione is O=C1CC(=O)CC(COc2cc(C(F)(F)F)cc(C(F)(F)F)c2)C1.
What is the InChIKey of 5-[[3,5-bis(trifluoromethyl)phenoxy]methyl]cyclohexane-1,3-dione?
The InChIKey is MCGIWMAVEWETEI-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H12F6O3/c16-14(17,18)9-3-10(15(19,20)21)5-13(4-9)24-7-8-1-11(22)6-12(23)2-8/h3-5,8H,1-2,6-7H2.
What are the key properties of 5-[[3,5-bis(trifluoromethyl)phenoxy]methyl]cyclohexane-1,3-dione?
5-[[3,5-bis(trifluoromethyl)phenoxy]methyl]cyclohexane-1,3-dione has a molecular weight of 354.25 g/mol, XLogP of 4.04, 3 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 5-[[3,5-bis(trifluoromethyl)phenoxy]methyl]cyclohexane-1,3-dione is sourced from PubChem (CID 52938086), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).