About 7,9-dimethyl-6H-indolo[3,2-b]quinoxaline
7,9-dimethyl-6H-indolo[3,2-b]quinoxaline (PubChem CID 5293815) has the molecular formula C16H13N3
and a molecular weight of 247.30 g/mol. Its IUPAC name is 7,9-dimethyl-6H-indolo[3,2-b]quinoxaline.
Molecular Properties
| Compound Name | 7,9-dimethyl-6H-indolo[3,2-b]quinoxaline |
| PubChem CID | 5293815 |
| Molecular Formula | C16H13N3 |
| Molecular Weight | 247.30 g/mol |
| Exact Mass | 247.11 |
| IUPAC Name | 7,9-dimethyl-6H-indolo[3,2-b]quinoxaline |
| SMILES | Cc1cc(C)c2[nH]c3nc4ccccc4nc3c2c1 |
| InChI | InChI=1S/C16H13N3/c1-9-7-10(2)14-11(8-9)15-16(19-14)18-13-6-4-3-5-12(13)17-15/h3-8H,1-2H3,(H,18,19) |
| InChIKey | JUOYIMZRGPYCIU-UHFFFAOYSA-N |
| XLogP | 3.88 |
| TPSA | 41.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 247.30 |
| LogP ≤ 5 | 3.88 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 7,9-dimethyl-6H-indolo[3,2-b]quinoxaline with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 7,9-dimethyl-6H-indolo[3,2-b]quinoxaline?
The IUPAC name of 7,9-dimethyl-6H-indolo[3,2-b]quinoxaline (CID 5293815) is 7,9-dimethyl-6H-indolo[3,2-b]quinoxaline.
What is the SMILES notation for 7,9-dimethyl-6H-indolo[3,2-b]quinoxaline?
The canonical SMILES for 7,9-dimethyl-6H-indolo[3,2-b]quinoxaline is Cc1cc(C)c2[nH]c3nc4ccccc4nc3c2c1.
What is the InChIKey of 7,9-dimethyl-6H-indolo[3,2-b]quinoxaline?
The InChIKey is JUOYIMZRGPYCIU-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H13N3/c1-9-7-10(2)14-11(8-9)15-16(19-14)18-13-6-4-3-5-12(13)17-15/h3-8H,1-2H3,(H,18,19).
What are the key properties of 7,9-dimethyl-6H-indolo[3,2-b]quinoxaline?
7,9-dimethyl-6H-indolo[3,2-b]quinoxaline has a molecular weight of 247.30 g/mol, XLogP of 3.88, 0 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 7,9-dimethyl-6H-indolo[3,2-b]quinoxaline is sourced from PubChem (CID 5293815), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).