About 5-[1-(2,5-difluorophenoxy)ethyl]cyclohexane-1,3-dione
5-[1-(2,5-difluorophenoxy)ethyl]cyclohexane-1,3-dione (PubChem CID 52938210) has the molecular formula C14H14F2O3
and a molecular weight of 268.26 g/mol. Its IUPAC name is 5-[1-(2,5-difluorophenoxy)ethyl]cyclohexane-1,3-dione.
Molecular Properties
| Compound Name | 5-[1-(2,5-difluorophenoxy)ethyl]cyclohexane-1,3-dione |
| PubChem CID | 52938210 |
| Molecular Formula | C14H14F2O3 |
| Molecular Weight | 268.26 g/mol |
| Exact Mass | 268.09 |
| IUPAC Name | 5-[1-(2,5-difluorophenoxy)ethyl]cyclohexane-1,3-dione |
| SMILES | CC(Oc1cc(F)ccc1F)C1CC(=O)CC(=O)C1 |
| InChI | InChI=1S/C14H14F2O3/c1-8(9-4-11(17)7-12(18)5-9)19-14-6-10(15)2-3-13(14)16/h2-3,6,8-9H,4-5,7H2,1H3 |
| InChIKey | MXZLJWDHHNBWPL-UHFFFAOYSA-N |
| XLogP | 2.67 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 268.26 |
| LogP ≤ 5 | 2.67 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|
Analyze 5-[1-(2,5-difluorophenoxy)ethyl]cyclohexane-1,3-dione with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-[1-(2,5-difluorophenoxy)ethyl]cyclohexane-1,3-dione?
The IUPAC name of 5-[1-(2,5-difluorophenoxy)ethyl]cyclohexane-1,3-dione (CID 52938210) is 5-[1-(2,5-difluorophenoxy)ethyl]cyclohexane-1,3-dione.
What is the SMILES notation for 5-[1-(2,5-difluorophenoxy)ethyl]cyclohexane-1,3-dione?
The canonical SMILES for 5-[1-(2,5-difluorophenoxy)ethyl]cyclohexane-1,3-dione is CC(Oc1cc(F)ccc1F)C1CC(=O)CC(=O)C1.
What is the InChIKey of 5-[1-(2,5-difluorophenoxy)ethyl]cyclohexane-1,3-dione?
The InChIKey is MXZLJWDHHNBWPL-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H14F2O3/c1-8(9-4-11(17)7-12(18)5-9)19-14-6-10(15)2-3-13(14)16/h2-3,6,8-9H,4-5,7H2,1H3.
What are the key properties of 5-[1-(2,5-difluorophenoxy)ethyl]cyclohexane-1,3-dione?
5-[1-(2,5-difluorophenoxy)ethyl]cyclohexane-1,3-dione has a molecular weight of 268.26 g/mol, XLogP of 2.67, 3 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 5-[1-(2,5-difluorophenoxy)ethyl]cyclohexane-1,3-dione is sourced from PubChem (CID 52938210), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).