C20H15ClN2O5 — CID 52938362
6-(4-chlorophenyl)-4-(furan-2-yl)-3-(4-nitrophenyl)-1,3-oxazinan-2-one (PubChem CID 52938362) has the molecular formula C20H15ClN2O5 and a molecular weight of 398.80 g/mol. Its IUPAC name is 6-(4-chlorophenyl)-4-(furan-2-yl)-3-(4-nitrophenyl)-1,3-oxazinan-2-one.
| Compound Name | 6-(4-chlorophenyl)-4-(furan-2-yl)-3-(4-nitrophenyl)-1,3-oxazinan-2-one |
|---|---|
| PubChem CID | 52938362 |
| Molecular Formula | C20H15ClN2O5 |
| Molecular Weight | 398.80 g/mol |
| Exact Mass | 398.07 |
| IUPAC Name | 6-(4-chlorophenyl)-4-(furan-2-yl)-3-(4-nitrophenyl)-1,3-oxazinan-2-one |
| SMILES | O=C1OC(c2ccc(Cl)cc2)CC(c2ccco2)N1c1ccc([N+](=O)[O-])cc1 |
| InChI | InChI=1S/C20H15ClN2O5/c21-14-5-3-13(4-6-14)19-12-17(18-2-1-11-27-18)22(20(24)28-19)15-7-9-16(10-8-15)23(25)26/h1-11,17,19H,12H2 |
| InChIKey | IRPWHMVFRCSVMR-UHFFFAOYSA-N |
| XLogP | 5.67 |
| TPSA | 85.82 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 398.80 |
| LogP ≤ 5 | 5.67 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|