C23H25F3N2O4 — CID 52938517
5-cyclopropyl-1-[2-hydroxy-2-[4-(trifluoromethoxy)phenyl]ethyl]-8-methoxy-3,6-dihydro-2H-1,5-benzodiazocin-4-one (PubChem CID 52938517) has the molecular formula C23H25F3N2O4 and a molecular weight of 450.46 g/mol. Its IUPAC name is 5-cyclopropyl-1-[2-hydroxy-2-[4-(trifluoromethoxy)phenyl]ethyl]-8-methoxy-3,6-dihydro-2H-1,5-benzodiazocin-4-one.
| Compound Name | 5-cyclopropyl-1-[2-hydroxy-2-[4-(trifluoromethoxy)phenyl]ethyl]-8-methoxy-3,6-dihydro-2H-1,5-benzodiazocin-4-one |
|---|---|
| PubChem CID | 52938517 |
| Molecular Formula | C23H25F3N2O4 |
| Molecular Weight | 450.46 g/mol |
| Exact Mass | 450.18 |
| IUPAC Name | 5-cyclopropyl-1-[2-hydroxy-2-[4-(trifluoromethoxy)phenyl]ethyl]-8-methoxy-3,6-dihydro-2H-1,5-benzodiazocin-4-one |
| SMILES | COc1ccc2c(c1)CN(C1CC1)C(=O)CCN2CC(O)c1ccc(OC(F)(F)F)cc1 |
| InChI | InChI=1S/C23H25F3N2O4/c1-31-19-8-9-20-16(12-19)13-28(17-4-5-17)22(30)10-11-27(20)14-21(29)15-2-6-18(7-3-15)32-23(24,25)26/h2-3,6-9,12,17,21,29H,4-5,10-11,13-14H2,1H3 |
| InChIKey | GUGUGUOZKYRPOI-UHFFFAOYSA-N |
| XLogP | 4.03 |
| TPSA | 62.24 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 450.46 |
| LogP ≤ 5 | 4.03 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'} |
|---|