C22H22N6O2 — CID 52938548
2-[(1S)-4-[5-(3-cyano-4-propan-2-yloxyphenyl)-1,2,4-oxadiazol-3-yl]-2,3-dihydro-1H-inden-1-yl]guanidine (PubChem CID 52938548) has the molecular formula C22H22N6O2 and a molecular weight of 402.46 g/mol. Its IUPAC name is 2-[(1S)-4-[5-(3-cyano-4-propan-2-yloxyphenyl)-1,2,4-oxadiazol-3-yl]-2,3-dihydro-1H-inden-1-yl]guanidine.
| Compound Name | 2-[(1S)-4-[5-(3-cyano-4-propan-2-yloxyphenyl)-1,2,4-oxadiazol-3-yl]-2,3-dihydro-1H-inden-1-yl]guanidine |
|---|---|
| PubChem CID | 52938548 |
| Molecular Formula | C22H22N6O2 |
| Molecular Weight | 402.46 g/mol |
| Exact Mass | 402.18 |
| IUPAC Name | 2-[(1S)-4-[5-(3-cyano-4-propan-2-yloxyphenyl)-1,2,4-oxadiazol-3-yl]-2,3-dihydro-1H-inden-1-yl]guanidine |
| SMILES | CC(C)Oc1ccc(-c2nc(-c3cccc4c3CC[C@@H]4N=C(N)N)no2)cc1C#N |
| InChI | InChI=1S/C22H22N6O2/c1-12(2)29-19-9-6-13(10-14(19)11-23)21-27-20(28-30-21)17-5-3-4-16-15(17)7-8-18(16)26-22(24)25/h3-6,9-10,12,18H,7-8H2,1-2H3,(H4,24,25,26)/t18-/m0/s1 |
| InChIKey | VZUTVMKBGITEJL-SFHVURJKSA-N |
| XLogP | 3.32 |
| TPSA | 136.34 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 402.46 |
| LogP ≤ 5 | 3.32 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|