C20H20N6O2 — CID 52938641
(E)-3-[4-amino-7-(3-hydroxypropyl)-5-(4-methylphenyl)pyrrolo[2,3-d]pyrimidin-6-yl]-2-cyanoprop-2-enamide (PubChem CID 52938641) has the molecular formula C20H20N6O2 and a molecular weight of 376.42 g/mol. Its IUPAC name is (E)-3-[4-amino-7-(3-hydroxypropyl)-5-(4-methylphenyl)pyrrolo[2,3-d]pyrimidin-6-yl]-2-cyanoprop-2-enamide.
| Compound Name | (E)-3-[4-amino-7-(3-hydroxypropyl)-5-(4-methylphenyl)pyrrolo[2,3-d]pyrimidin-6-yl]-2-cyanoprop-2-enamide |
|---|---|
| PubChem CID | 52938641 |
| Molecular Formula | C20H20N6O2 |
| Molecular Weight | 376.42 g/mol |
| Exact Mass | 376.16 |
| IUPAC Name | (E)-3-[4-amino-7-(3-hydroxypropyl)-5-(4-methylphenyl)pyrrolo[2,3-d]pyrimidin-6-yl]-2-cyanoprop-2-enamide |
| SMILES | Cc1ccc(-c2c(/C=C(\C#N)C(N)=O)n(CCCO)c3ncnc(N)c23)cc1 |
| InChI | InChI=1S/C20H20N6O2/c1-12-3-5-13(6-4-12)16-15(9-14(10-21)19(23)28)26(7-2-8-27)20-17(16)18(22)24-11-25-20/h3-6,9,11,27H,2,7-8H2,1H3,(H2,23,28)(H2,22,24,25)/b14-9+ |
| InChIKey | SZAXHJXUPGRTIP-NTEUORMPSA-N |
| XLogP | 1.76 |
| TPSA | 143.84 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 376.42 |
| LogP ≤ 5 | 1.76 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|