C27H26N6O2 — CID 52938642
(E)-3-[4-amino-7-(3-hydroxypropyl)-5-(4-methylphenyl)pyrrolo[2,3-d]pyrimidin-6-yl]-N-benzyl-2-cyanoprop-2-enamide (PubChem CID 52938642) has the molecular formula C27H26N6O2 and a molecular weight of 466.55 g/mol. Its IUPAC name is (E)-3-[4-amino-7-(3-hydroxypropyl)-5-(4-methylphenyl)pyrrolo[2,3-d]pyrimidin-6-yl]-N-benzyl-2-cyanoprop-2-enamide.
| Compound Name | (E)-3-[4-amino-7-(3-hydroxypropyl)-5-(4-methylphenyl)pyrrolo[2,3-d]pyrimidin-6-yl]-N-benzyl-2-cyanoprop-2-enamide |
|---|---|
| PubChem CID | 52938642 |
| Molecular Formula | C27H26N6O2 |
| Molecular Weight | 466.55 g/mol |
| Exact Mass | 466.21 |
| IUPAC Name | (E)-3-[4-amino-7-(3-hydroxypropyl)-5-(4-methylphenyl)pyrrolo[2,3-d]pyrimidin-6-yl]-N-benzyl-2-cyanoprop-2-enamide |
| SMILES | Cc1ccc(-c2c(/C=C(\C#N)C(=O)NCc3ccccc3)n(CCCO)c3ncnc(N)c23)cc1 |
| InChI | InChI=1S/C27H26N6O2/c1-18-8-10-20(11-9-18)23-22(33(12-5-13-34)26-24(23)25(29)31-17-32-26)14-21(15-28)27(35)30-16-19-6-3-2-4-7-19/h2-4,6-11,14,17,34H,5,12-13,16H2,1H3,(H,30,35)(H2,29,31,32)/b21-14+ |
| InChIKey | VGLWJTYWGAMQMT-KGENOOAVSA-N |
| XLogP | 3.59 |
| TPSA | 129.85 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 466.55 |
| LogP ≤ 5 | 3.59 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|