C24H26N6O2 — CID 52938645
(E)-3-[4-amino-7-(3-hydroxypropyl)-5-(4-methylphenyl)pyrrolo[2,3-d]pyrimidin-6-yl]-2-(pyrrolidine-1-carbonyl)prop-2-enenitrile (PubChem CID 52938645) has the molecular formula C24H26N6O2 and a molecular weight of 430.51 g/mol. Its IUPAC name is (E)-3-[4-amino-7-(3-hydroxypropyl)-5-(4-methylphenyl)pyrrolo[2,3-d]pyrimidin-6-yl]-2-(pyrrolidine-1-carbonyl)prop-2-enenitrile.
| Compound Name | (E)-3-[4-amino-7-(3-hydroxypropyl)-5-(4-methylphenyl)pyrrolo[2,3-d]pyrimidin-6-yl]-2-(pyrrolidine-1-carbonyl)prop-2-enenitrile |
|---|---|
| PubChem CID | 52938645 |
| Molecular Formula | C24H26N6O2 |
| Molecular Weight | 430.51 g/mol |
| Exact Mass | 430.21 |
| IUPAC Name | (E)-3-[4-amino-7-(3-hydroxypropyl)-5-(4-methylphenyl)pyrrolo[2,3-d]pyrimidin-6-yl]-2-(pyrrolidine-1-carbonyl)prop-2-enenitrile |
| SMILES | Cc1ccc(-c2c(/C=C(\C#N)C(=O)N3CCCC3)n(CCCO)c3ncnc(N)c23)cc1 |
| InChI | InChI=1S/C24H26N6O2/c1-16-5-7-17(8-6-16)20-19(13-18(14-25)24(32)29-9-2-3-10-29)30(11-4-12-31)23-21(20)22(26)27-15-28-23/h5-8,13,15,31H,2-4,9-12H2,1H3,(H2,26,27,28)/b18-13+ |
| InChIKey | HUNVXONHJJSTOV-QGOAFFKASA-N |
| XLogP | 2.90 |
| TPSA | 121.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 430.51 |
| LogP ≤ 5 | 2.90 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|