C11H23ClO8S — CID 52938729
(2S,3R,4R,5S)-6-[(2R,3S,4S)-3,4-dihydroxy-2-(hydroxymethyl)thiolan-1-ium-1-yl]hexane-1,2,3,4,5-pentol chloride (PubChem CID 52938729) has the molecular formula C11H23ClO8S and a molecular weight of 350.82 g/mol. Its IUPAC name is (2S,3R,4R,5S)-6-[(2R,3S,4S)-3,4-dihydroxy-2-(hydroxymethyl)thiolan-1-ium-1-yl]hexane-1,2,3,4,5-pentol chloride.
| Compound Name | (2S,3R,4R,5S)-6-[(2R,3S,4S)-3,4-dihydroxy-2-(hydroxymethyl)thiolan-1-ium-1-yl]hexane-1,2,3,4,5-pentol chloride |
|---|---|
| PubChem CID | 52938729 |
| Molecular Formula | C11H23ClO8S |
| Molecular Weight | 350.82 g/mol |
| Exact Mass | 350.08 |
| IUPAC Name | (2S,3R,4R,5S)-6-[(2R,3S,4S)-3,4-dihydroxy-2-(hydroxymethyl)thiolan-1-ium-1-yl]hexane-1,2,3,4,5-pentol chloride |
| SMILES | OC[C@@H]1[C@@H](O)[C@H](O)C[S+]1C[C@@H](O)[C@H](O)[C@H](O)[C@@H](O)CO.[Cl-] |
| InChI | InChI=1S/C11H23O8S.ClH/c12-1-5(14)10(18)11(19)7(16)4-20-3-6(15)9(17)8(20)2-13;/h5-19H,1-4H2;1H/q+1;/p-1/t5-,6+,7+,8+,9-,10+,11-,20?;/m0./s1 |
| InChIKey | ATEIRTWZLSRKMU-JSQVWYGLSA-M |
| XLogP | -7.86 |
| TPSA | 161.84 Ų |
| H-Bond Donors | 8 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 350.82 |
| LogP ≤ 5 | -7.86 |
| H-Bond Donors ≤ 5 | 8 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'charged_oxygen_or_sulfur_atoms', 'substructure': 'N/A'} |
|---|