C22H24N6O2 — CID 52938768
(E)-3-[4-amino-7-(3-hydroxypropyl)-5-(4-methylphenyl)pyrrolo[2,3-d]pyrimidin-6-yl]-2-cyano-N,N-dimethylprop-2-enamide (PubChem CID 52938768) has the molecular formula C22H24N6O2 and a molecular weight of 404.47 g/mol. Its IUPAC name is (E)-3-[4-amino-7-(3-hydroxypropyl)-5-(4-methylphenyl)pyrrolo[2,3-d]pyrimidin-6-yl]-2-cyano-N,N-dimethylprop-2-enamide.
| Compound Name | (E)-3-[4-amino-7-(3-hydroxypropyl)-5-(4-methylphenyl)pyrrolo[2,3-d]pyrimidin-6-yl]-2-cyano-N,N-dimethylprop-2-enamide |
|---|---|
| PubChem CID | 52938768 |
| Molecular Formula | C22H24N6O2 |
| Molecular Weight | 404.47 g/mol |
| Exact Mass | 404.20 |
| IUPAC Name | (E)-3-[4-amino-7-(3-hydroxypropyl)-5-(4-methylphenyl)pyrrolo[2,3-d]pyrimidin-6-yl]-2-cyano-N,N-dimethylprop-2-enamide |
| SMILES | Cc1ccc(-c2c(/C=C(\C#N)C(=O)N(C)C)n(CCCO)c3ncnc(N)c23)cc1 |
| InChI | InChI=1S/C22H24N6O2/c1-14-5-7-15(8-6-14)18-17(11-16(12-23)22(30)27(2)3)28(9-4-10-29)21-19(18)20(24)25-13-26-21/h5-8,11,13,29H,4,9-10H2,1-3H3,(H2,24,25,26)/b16-11+ |
| InChIKey | JOMCSJCBXRQYAV-LFIBNONCSA-N |
| XLogP | 2.37 |
| TPSA | 121.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 404.47 |
| LogP ≤ 5 | 2.37 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|