C26H32N2O — CID 52938838
(5R,10S,13S)-17-(benzimidazol-1-yl)-10,13-dimethyl-1,2,4,5,6,7,8,9,11,12,14,15-dodecahydrocyclopenta[a]phenanthren-3-one (PubChem CID 52938838) has the molecular formula C26H32N2O and a molecular weight of 388.56 g/mol. Its IUPAC name is (5R,10S,13S)-17-(benzimidazol-1-yl)-10,13-dimethyl-1,2,4,5,6,7,8,9,11,12,14,15-dodecahydrocyclopenta[a]phenanthren-3-one.
| Compound Name | (5R,10S,13S)-17-(benzimidazol-1-yl)-10,13-dimethyl-1,2,4,5,6,7,8,9,11,12,14,15-dodecahydrocyclopenta[a]phenanthren-3-one |
|---|---|
| PubChem CID | 52938838 |
| Molecular Formula | C26H32N2O |
| Molecular Weight | 388.56 g/mol |
| Exact Mass | 388.25 |
| IUPAC Name | (5R,10S,13S)-17-(benzimidazol-1-yl)-10,13-dimethyl-1,2,4,5,6,7,8,9,11,12,14,15-dodecahydrocyclopenta[a]phenanthren-3-one |
| SMILES | C[C@]12CCC3C(CC[C@@H]4CC(=O)CC[C@]34C)C1CC=C2n1cnc2ccccc21 |
| InChI | InChI=1S/C26H32N2O/c1-25-13-11-18(29)15-17(25)7-8-19-20-9-10-24(26(20,2)14-12-21(19)25)28-16-27-22-5-3-4-6-23(22)28/h3-6,10,16-17,19-21H,7-9,11-15H2,1-2H3/t17-,19?,20?,21?,25+,26+/m1/s1 |
| InChIKey | LYLZWDUBNUHGHX-VHXASEIPSA-N |
| XLogP | 6.10 |
| TPSA | 34.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 388.56 |
| LogP ≤ 5 | 6.10 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |