C12H9Cl3O2 — CID 52938960
5-(2,4,6-trichlorophenyl)cyclohexane-1,3-dione (PubChem CID 52938960) has the molecular formula C12H9Cl3O2 and a molecular weight of 291.56 g/mol. Its IUPAC name is 5-(2,4,6-trichlorophenyl)cyclohexane-1,3-dione.
| Compound Name | 5-(2,4,6-trichlorophenyl)cyclohexane-1,3-dione |
|---|---|
| PubChem CID | 52938960 |
| Molecular Formula | C12H9Cl3O2 |
| Molecular Weight | 291.56 g/mol |
| Exact Mass | 289.97 |
| IUPAC Name | 5-(2,4,6-trichlorophenyl)cyclohexane-1,3-dione |
| SMILES | O=C1CC(=O)CC(c2c(Cl)cc(Cl)cc2Cl)C1 |
| InChI | InChI=1S/C12H9Cl3O2/c13-7-3-10(14)12(11(15)4-7)6-1-8(16)5-9(17)2-6/h3-4,6H,1-2,5H2 |
| InChIKey | VHLADAWLMQCFPD-UHFFFAOYSA-N |
| XLogP | 4.05 |
| TPSA | 34.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 291.56 |
| LogP ≤ 5 | 4.05 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|