C25H29N7O2 — CID 52939144
(E)-3-[4-amino-7-(3-hydroxypropyl)-5-(4-methylphenyl)pyrrolo[2,3-d]pyrimidin-6-yl]-2-(4-methylpiperazine-1-carbonyl)prop-2-enenitrile (PubChem CID 52939144) has the molecular formula C25H29N7O2 and a molecular weight of 459.55 g/mol. Its IUPAC name is (E)-3-[4-amino-7-(3-hydroxypropyl)-5-(4-methylphenyl)pyrrolo[2,3-d]pyrimidin-6-yl]-2-(4-methylpiperazine-1-carbonyl)prop-2-enenitrile.
| Compound Name | (E)-3-[4-amino-7-(3-hydroxypropyl)-5-(4-methylphenyl)pyrrolo[2,3-d]pyrimidin-6-yl]-2-(4-methylpiperazine-1-carbonyl)prop-2-enenitrile |
|---|---|
| PubChem CID | 52939144 |
| Molecular Formula | C25H29N7O2 |
| Molecular Weight | 459.55 g/mol |
| Exact Mass | 459.24 |
| IUPAC Name | (E)-3-[4-amino-7-(3-hydroxypropyl)-5-(4-methylphenyl)pyrrolo[2,3-d]pyrimidin-6-yl]-2-(4-methylpiperazine-1-carbonyl)prop-2-enenitrile |
| SMILES | Cc1ccc(-c2c(/C=C(\C#N)C(=O)N3CCN(C)CC3)n(CCCO)c3ncnc(N)c23)cc1 |
| InChI | InChI=1S/C25H29N7O2/c1-17-4-6-18(7-5-17)21-20(14-19(15-26)25(34)31-11-9-30(2)10-12-31)32(8-3-13-33)24-22(21)23(27)28-16-29-24/h4-7,14,16,33H,3,8-13H2,1-2H3,(H2,27,28,29)/b19-14+ |
| InChIKey | ABLOIHSPETWVRL-XMHGGMMESA-N |
| XLogP | 2.05 |
| TPSA | 124.30 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 459.55 |
| LogP ≤ 5 | 2.05 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|