C23H24N6O3 — CID 52939146
(E)-3-[4-amino-7-(3-hydroxypropyl)-5-(4-methylphenyl)pyrrolo[2,3-d]pyrimidin-6-yl]-2-(3-hydroxyazetidine-1-carbonyl)prop-2-enenitrile (PubChem CID 52939146) has the molecular formula C23H24N6O3 and a molecular weight of 432.48 g/mol. Its IUPAC name is (E)-3-[4-amino-7-(3-hydroxypropyl)-5-(4-methylphenyl)pyrrolo[2,3-d]pyrimidin-6-yl]-2-(3-hydroxyazetidine-1-carbonyl)prop-2-enenitrile.
| Compound Name | (E)-3-[4-amino-7-(3-hydroxypropyl)-5-(4-methylphenyl)pyrrolo[2,3-d]pyrimidin-6-yl]-2-(3-hydroxyazetidine-1-carbonyl)prop-2-enenitrile |
|---|---|
| PubChem CID | 52939146 |
| Molecular Formula | C23H24N6O3 |
| Molecular Weight | 432.48 g/mol |
| Exact Mass | 432.19 |
| IUPAC Name | (E)-3-[4-amino-7-(3-hydroxypropyl)-5-(4-methylphenyl)pyrrolo[2,3-d]pyrimidin-6-yl]-2-(3-hydroxyazetidine-1-carbonyl)prop-2-enenitrile |
| SMILES | Cc1ccc(-c2c(/C=C(\C#N)C(=O)N3CC(O)C3)n(CCCO)c3ncnc(N)c23)cc1 |
| InChI | InChI=1S/C23H24N6O3/c1-14-3-5-15(6-4-14)19-18(9-16(10-24)23(32)28-11-17(31)12-28)29(7-2-8-30)22-20(19)21(25)26-13-27-22/h3-6,9,13,17,30-31H,2,7-8,11-12H2,1H3,(H2,25,26,27)/b16-9+ |
| InChIKey | LHVAADCVTGAJMC-CXUHLZMHSA-N |
| XLogP | 1.48 |
| TPSA | 141.29 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 432.48 |
| LogP ≤ 5 | 1.48 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|