C15H24N2O5 — CID 52939315
5-[(2-tert-butyl-5-methyl-1,3-oxazol-4-yl)methyl]-N-hydroxy-2-methyl-1,3-dioxane-2-carboxamide (PubChem CID 52939315) has the molecular formula C15H24N2O5 and a molecular weight of 312.37 g/mol. Its IUPAC name is 5-[(2-tert-butyl-5-methyl-1,3-oxazol-4-yl)methyl]-N-hydroxy-2-methyl-1,3-dioxane-2-carboxamide.
| Compound Name | 5-[(2-tert-butyl-5-methyl-1,3-oxazol-4-yl)methyl]-N-hydroxy-2-methyl-1,3-dioxane-2-carboxamide |
|---|---|
| PubChem CID | 52939315 |
| Molecular Formula | C15H24N2O5 |
| Molecular Weight | 312.37 g/mol |
| Exact Mass | 312.17 |
| IUPAC Name | 5-[(2-tert-butyl-5-methyl-1,3-oxazol-4-yl)methyl]-N-hydroxy-2-methyl-1,3-dioxane-2-carboxamide |
| SMILES | Cc1oc(C(C)(C)C)nc1CC1COC(C)(C(=O)NO)OC1 |
| InChI | InChI=1S/C15H24N2O5/c1-9-11(16-13(22-9)14(2,3)4)6-10-7-20-15(5,21-8-10)12(18)17-19/h10,19H,6-8H2,1-5H3,(H,17,18) |
| InChIKey | QWHQAXFGMSHAJT-UHFFFAOYSA-N |
| XLogP | 1.71 |
| TPSA | 93.82 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 312.37 |
| LogP ≤ 5 | 1.71 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|