C22H21N5O2S — CID 52939360
N,2,5-trimethyl-N-[(E)-(6-pyridin-3-ylimidazo[1,2-a]pyridin-3-yl)methylideneamino]benzenesulfonamide (PubChem CID 52939360) has the molecular formula C22H21N5O2S and a molecular weight of 419.51 g/mol. Its IUPAC name is N,2,5-trimethyl-N-[(E)-(6-pyridin-3-ylimidazo[1,2-a]pyridin-3-yl)methylideneamino]benzenesulfonamide.
| Compound Name | N,2,5-trimethyl-N-[(E)-(6-pyridin-3-ylimidazo[1,2-a]pyridin-3-yl)methylideneamino]benzenesulfonamide |
|---|---|
| PubChem CID | 52939360 |
| Molecular Formula | C22H21N5O2S |
| Molecular Weight | 419.51 g/mol |
| Exact Mass | 419.14 |
| IUPAC Name | N,2,5-trimethyl-N-[(E)-(6-pyridin-3-ylimidazo[1,2-a]pyridin-3-yl)methylideneamino]benzenesulfonamide |
| SMILES | Cc1ccc(C)c(S(=O)(=O)N(C)/N=C/c2cnc3ccc(-c4cccnc4)cn23)c1 |
| InChI | InChI=1S/C22H21N5O2S/c1-16-6-7-17(2)21(11-16)30(28,29)26(3)25-14-20-13-24-22-9-8-19(15-27(20)22)18-5-4-10-23-12-18/h4-15H,1-3H3/b25-14+ |
| InChIKey | ISTRCKALJKOSAJ-AFUMVMLFSA-N |
| XLogP | 3.67 |
| TPSA | 79.93 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 419.51 |
| LogP ≤ 5 | 3.67 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|