C15H23NO3 — CID 52939605
(2S,3S,4S,5S)-2-(hydroxymethyl)-5-(4-phenylbutyl)pyrrolidine-3,4-diol (PubChem CID 52939605) has the molecular formula C15H23NO3 and a molecular weight of 265.35 g/mol. Its IUPAC name is (2S,3S,4S,5S)-2-(hydroxymethyl)-5-(4-phenylbutyl)pyrrolidine-3,4-diol.
| Compound Name | (2S,3S,4S,5S)-2-(hydroxymethyl)-5-(4-phenylbutyl)pyrrolidine-3,4-diol |
|---|---|
| PubChem CID | 52939605 |
| Molecular Formula | C15H23NO3 |
| Molecular Weight | 265.35 g/mol |
| Exact Mass | 265.17 |
| IUPAC Name | (2S,3S,4S,5S)-2-(hydroxymethyl)-5-(4-phenylbutyl)pyrrolidine-3,4-diol |
| SMILES | OC[C@@H]1N[C@@H](CCCCc2ccccc2)[C@H](O)[C@H]1O |
| InChI | InChI=1S/C15H23NO3/c17-10-13-15(19)14(18)12(16-13)9-5-4-8-11-6-2-1-3-7-11/h1-3,6-7,12-19H,4-5,8-10H2/t12-,13-,14-,15-/m0/s1 |
| InChIKey | CATONQSSWBTCAE-AJNGGQMLSA-N |
| XLogP | 0.45 |
| TPSA | 72.72 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 265.35 |
| LogP ≤ 5 | 0.45 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|