C11H23NO3 — CID 52939606
(2S,3S,4S,5S)-2-hexyl-5-(hydroxymethyl)pyrrolidine-3,4-diol (PubChem CID 52939606) has the molecular formula C11H23NO3 and a molecular weight of 217.31 g/mol. Its IUPAC name is (2S,3S,4S,5S)-2-hexyl-5-(hydroxymethyl)pyrrolidine-3,4-diol.
| Compound Name | (2S,3S,4S,5S)-2-hexyl-5-(hydroxymethyl)pyrrolidine-3,4-diol |
|---|---|
| PubChem CID | 52939606 |
| Molecular Formula | C11H23NO3 |
| Molecular Weight | 217.31 g/mol |
| Exact Mass | 217.17 |
| IUPAC Name | (2S,3S,4S,5S)-2-hexyl-5-(hydroxymethyl)pyrrolidine-3,4-diol |
| SMILES | CCCCCC[C@@H]1N[C@@H](CO)[C@H](O)[C@H]1O |
| InChI | InChI=1S/C11H23NO3/c1-2-3-4-5-6-8-10(14)11(15)9(7-13)12-8/h8-15H,2-7H2,1H3/t8-,9-,10-,11-/m0/s1 |
| InChIKey | QMSPEQOEFDFBDC-NAKRPEOUSA-N |
| XLogP | 0.01 |
| TPSA | 72.72 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 217.31 |
| LogP ≤ 5 | 0.01 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|