C33H35N7O2 — CID 52939767
9-(1,3-benzodioxol-5-yl)-N-[3-[4-(2,3-dimethylphenyl)piperazin-1-yl]propyl]-8-phenylpurin-6-amine (PubChem CID 52939767) has the molecular formula C33H35N7O2 and a molecular weight of 561.69 g/mol. Its IUPAC name is 9-(1,3-benzodioxol-5-yl)-N-[3-[4-(2,3-dimethylphenyl)piperazin-1-yl]propyl]-8-phenylpurin-6-amine.
| Compound Name | 9-(1,3-benzodioxol-5-yl)-N-[3-[4-(2,3-dimethylphenyl)piperazin-1-yl]propyl]-8-phenylpurin-6-amine |
|---|---|
| PubChem CID | 52939767 |
| Molecular Formula | C33H35N7O2 |
| Molecular Weight | 561.69 g/mol |
| Exact Mass | 561.29 |
| IUPAC Name | 9-(1,3-benzodioxol-5-yl)-N-[3-[4-(2,3-dimethylphenyl)piperazin-1-yl]propyl]-8-phenylpurin-6-amine |
| SMILES | Cc1cccc(N2CCN(CCCNc3ncnc4c3nc(-c3ccccc3)n4-c3ccc4c(c3)OCO4)CC2)c1C |
| InChI | InChI=1S/C33H35N7O2/c1-23-8-6-11-27(24(23)2)39-18-16-38(17-19-39)15-7-14-34-31-30-33(36-21-35-31)40(32(37-30)25-9-4-3-5-10-25)26-12-13-28-29(20-26)42-22-41-28/h3-6,8-13,20-21H,7,14-19,22H2,1-2H3,(H,34,35,36) |
| InChIKey | CBBBLFONMJOVFT-UHFFFAOYSA-N |
| XLogP | 5.45 |
| TPSA | 80.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 561.69 |
| LogP ≤ 5 | 5.45 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|