C34H37N7O2 — CID 52939768
9-(2,3-dihydro-1,4-benzodioxin-6-yl)-N-[3-[4-(2,3-dimethylphenyl)piperazin-1-yl]propyl]-8-phenylpurin-6-amine (PubChem CID 52939768) has the molecular formula C34H37N7O2 and a molecular weight of 575.72 g/mol. Its IUPAC name is 9-(2,3-dihydro-1,4-benzodioxin-6-yl)-N-[3-[4-(2,3-dimethylphenyl)piperazin-1-yl]propyl]-8-phenylpurin-6-amine.
| Compound Name | 9-(2,3-dihydro-1,4-benzodioxin-6-yl)-N-[3-[4-(2,3-dimethylphenyl)piperazin-1-yl]propyl]-8-phenylpurin-6-amine |
|---|---|
| PubChem CID | 52939768 |
| Molecular Formula | C34H37N7O2 |
| Molecular Weight | 575.72 g/mol |
| Exact Mass | 575.30 |
| IUPAC Name | 9-(2,3-dihydro-1,4-benzodioxin-6-yl)-N-[3-[4-(2,3-dimethylphenyl)piperazin-1-yl]propyl]-8-phenylpurin-6-amine |
| SMILES | Cc1cccc(N2CCN(CCCNc3ncnc4c3nc(-c3ccccc3)n4-c3ccc4c(c3)OCCO4)CC2)c1C |
| InChI | InChI=1S/C34H37N7O2/c1-24-8-6-11-28(25(24)2)40-18-16-39(17-19-40)15-7-14-35-32-31-34(37-23-36-32)41(33(38-31)26-9-4-3-5-10-26)27-12-13-29-30(22-27)43-21-20-42-29/h3-6,8-13,22-23H,7,14-21H2,1-2H3,(H,35,36,37) |
| InChIKey | YPYMSERUEMUCCI-UHFFFAOYSA-N |
| XLogP | 5.49 |
| TPSA | 80.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 575.72 |
| LogP ≤ 5 | 5.49 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|