C19H24N2O3 — CID 52939787
(3aS,5R,6S)-2-(1-azabicyclo[2.2.2]octan-3-yl)-5,6-dihydroxy-3a,4,5,6-tetrahydro-3H-benzo[de]isoquinolin-1-one (PubChem CID 52939787) has the molecular formula C19H24N2O3 and a molecular weight of 328.41 g/mol. Its IUPAC name is (3aS,5R,6S)-2-(1-azabicyclo[2.2.2]octan-3-yl)-5,6-dihydroxy-3a,4,5,6-tetrahydro-3H-benzo[de]isoquinolin-1-one.
| Compound Name | (3aS,5R,6S)-2-(1-azabicyclo[2.2.2]octan-3-yl)-5,6-dihydroxy-3a,4,5,6-tetrahydro-3H-benzo[de]isoquinolin-1-one |
|---|---|
| PubChem CID | 52939787 |
| Molecular Formula | C19H24N2O3 |
| Molecular Weight | 328.41 g/mol |
| Exact Mass | 328.18 |
| IUPAC Name | (3aS,5R,6S)-2-(1-azabicyclo[2.2.2]octan-3-yl)-5,6-dihydroxy-3a,4,5,6-tetrahydro-3H-benzo[de]isoquinolin-1-one |
| SMILES | O=C1c2cccc3c2[C@H](C[C@@H](O)[C@H]3O)CN1C1CN2CCC1CC2 |
| InChI | InChI=1S/C19H24N2O3/c22-16-8-12-9-21(15-10-20-6-4-11(15)5-7-20)19(24)14-3-1-2-13(17(12)14)18(16)23/h1-3,11-12,15-16,18,22-23H,4-10H2/t12-,15?,16-,18+/m1/s1 |
| InChIKey | IYCGTSMCSZBYDG-QXMNMAACSA-N |
| XLogP | 1.12 |
| TPSA | 64.01 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 328.41 |
| LogP ≤ 5 | 1.12 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |