C24H28ClNO3 — CID 52939851
(14aR)-3,6,7-trimethoxy-11,12,13,14,14a,15-hexahydro-9H-phenanthro[9,10-b]quinolizine;hydrochloride (PubChem CID 52939851) has the molecular formula C24H28ClNO3 and a molecular weight of 413.95 g/mol. Its IUPAC name is (14aR)-3,6,7-trimethoxy-11,12,13,14,14a,15-hexahydro-9H-phenanthro[9,10-b]quinolizine;hydrochloride.
| Compound Name | (14aR)-3,6,7-trimethoxy-11,12,13,14,14a,15-hexahydro-9H-phenanthro[9,10-b]quinolizine;hydrochloride |
|---|---|
| PubChem CID | 52939851 |
| Molecular Formula | C24H28ClNO3 |
| Molecular Weight | 413.95 g/mol |
| Exact Mass | 413.18 |
| IUPAC Name | (14aR)-3,6,7-trimethoxy-11,12,13,14,14a,15-hexahydro-9H-phenanthro[9,10-b]quinolizine;hydrochloride |
| SMILES | COc1ccc2c3c(c4cc(OC)c(OC)cc4c2c1)CN1CCCC[C@@H]1C3.Cl |
| InChI | InChI=1S/C24H27NO3.ClH/c1-26-16-7-8-17-18-10-15-6-4-5-9-25(15)14-22(18)21-13-24(28-3)23(27-2)12-20(21)19(17)11-16;/h7-8,11-13,15H,4-6,9-10,14H2,1-3H3;1H/t15-;/m1./s1 |
| InChIKey | PJOSNBIIQOVWGZ-XFULWGLBSA-N |
| XLogP | 5.35 |
| TPSA | 30.93 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 413.95 |
| LogP ≤ 5 | 5.35 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|