About 2-[4-amino-6-[(E)-2-pyridin-3-ylethenyl]-1,3,5-triazin-2-yl]phenol
2-[4-amino-6-[(E)-2-pyridin-3-ylethenyl]-1,3,5-triazin-2-yl]phenol (PubChem CID 5293992) has the molecular formula C16H13N5O
and a molecular weight of 291.31 g/mol. Its IUPAC name is 2-[4-amino-6-[(E)-2-pyridin-3-ylethenyl]-1,3,5-triazin-2-yl]phenol.
Molecular Properties
| Compound Name | 2-[4-amino-6-[(E)-2-pyridin-3-ylethenyl]-1,3,5-triazin-2-yl]phenol |
| PubChem CID | 5293992 |
| Molecular Formula | C16H13N5O |
| Molecular Weight | 291.31 g/mol |
| Exact Mass | 291.11 |
| IUPAC Name | 2-[4-amino-6-[(E)-2-pyridin-3-ylethenyl]-1,3,5-triazin-2-yl]phenol |
| SMILES | Nc1nc(/C=C/c2cccnc2)nc(-c2ccccc2O)n1 |
| InChI | InChI=1S/C16H13N5O/c17-16-20-14(8-7-11-4-3-9-18-10-11)19-15(21-16)12-5-1-2-6-13(12)22/h1-10,22H,(H2,17,19,20,21)/b8-7+ |
| InChIKey | WTGHURLGUXYVQE-BQYQJAHWSA-N |
| XLogP | 2.39 |
| TPSA | 97.81 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 291.31 |
| LogP ≤ 5 | 2.39 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze 2-[4-amino-6-[(E)-2-pyridin-3-ylethenyl]-1,3,5-triazin-2-yl]phenol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[4-amino-6-[(E)-2-pyridin-3-ylethenyl]-1,3,5-triazin-2-yl]phenol?
The IUPAC name of 2-[4-amino-6-[(E)-2-pyridin-3-ylethenyl]-1,3,5-triazin-2-yl]phenol (CID 5293992) is 2-[4-amino-6-[(E)-2-pyridin-3-ylethenyl]-1,3,5-triazin-2-yl]phenol.
What is the SMILES notation for 2-[4-amino-6-[(E)-2-pyridin-3-ylethenyl]-1,3,5-triazin-2-yl]phenol?
The canonical SMILES for 2-[4-amino-6-[(E)-2-pyridin-3-ylethenyl]-1,3,5-triazin-2-yl]phenol is Nc1nc(/C=C/c2cccnc2)nc(-c2ccccc2O)n1.
What is the InChIKey of 2-[4-amino-6-[(E)-2-pyridin-3-ylethenyl]-1,3,5-triazin-2-yl]phenol?
The InChIKey is WTGHURLGUXYVQE-BQYQJAHWSA-N. The full InChI is InChI=1S/C16H13N5O/c17-16-20-14(8-7-11-4-3-9-18-10-11)19-15(21-16)12-5-1-2-6-13(12)22/h1-10,22H,(H2,17,19,20,21)/b8-7+.
What are the key properties of 2-[4-amino-6-[(E)-2-pyridin-3-ylethenyl]-1,3,5-triazin-2-yl]phenol?
2-[4-amino-6-[(E)-2-pyridin-3-ylethenyl]-1,3,5-triazin-2-yl]phenol has a molecular weight of 291.31 g/mol, XLogP of 2.39, 3 rotatable bonds, 2 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[4-amino-6-[(E)-2-pyridin-3-ylethenyl]-1,3,5-triazin-2-yl]phenol is sourced from PubChem (CID 5293992), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).