(2Z,4E)-7-methylocta-2,4-dienoic acid

C9H14O2 — CID 52940546

IUPAC(2Z,4E)-7-methylocta-2,4-dienoic acid
SMILESCC(C)C/C=C/C=C\C(=O)O
InChIInChI=1S/C9H14O2/c1-8(2)6-4-3-5-7-9(10)11/h3-5,7-8H,6H2,1-2H3,(H,10,11)/b4-3+,7-5-
InChIKeyZPJFGJWTSDWBST-BZDQXIRASA-N
MW154.21 g/mol
LogP2.23
Rot. Bonds4

About (2Z,4E)-7-methylocta-2,4-dienoic acid

(2Z,4E)-7-methylocta-2,4-dienoic acid (PubChem CID 52940546) has the molecular formula C9H14O2 and a molecular weight of 154.21 g/mol. Its IUPAC name is (2Z,4E)-7-methylocta-2,4-dienoic acid.

Molecular Properties

Compound Name(2Z,4E)-7-methylocta-2,4-dienoic acid
PubChem CID52940546
Molecular FormulaC9H14O2
Molecular Weight154.21 g/mol
Exact Mass154.10
IUPAC Name(2Z,4E)-7-methylocta-2,4-dienoic acid
SMILESCC(C)C/C=C/C=C\C(=O)O
InChIInChI=1S/C9H14O2/c1-8(2)6-4-3-5-7-9(10)11/h3-5,7-8H,6H2,1-2H3,(H,10,11)/b4-3+,7-5-
InChIKeyZPJFGJWTSDWBST-BZDQXIRASA-N
XLogP2.23
TPSA37.30 Ų
H-Bond Donors1
H-Bond Acceptors1
Rotatable Bonds4
Heavy Atoms11
Complexity—

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500154.21
LogP ≤ 52.23
H-Bond Donors ≤ 51
H-Bond Acceptors ≤ 101

Computed Properties (RDKit)

Structural Alerts{'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'}

Analyze (2Z,4E)-7-methylocta-2,4-dienoic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of (2Z,4E)-7-methylocta-2,4-dienoic acid?
The IUPAC name of (2Z,4E)-7-methylocta-2,4-dienoic acid (CID 52940546) is (2Z,4E)-7-methylocta-2,4-dienoic acid.
What is the SMILES notation for (2Z,4E)-7-methylocta-2,4-dienoic acid?
The canonical SMILES for (2Z,4E)-7-methylocta-2,4-dienoic acid is CC(C)C/C=C/C=C\C(=O)O.
What is the InChIKey of (2Z,4E)-7-methylocta-2,4-dienoic acid?
The InChIKey is ZPJFGJWTSDWBST-BZDQXIRASA-N. The full InChI is InChI=1S/C9H14O2/c1-8(2)6-4-3-5-7-9(10)11/h3-5,7-8H,6H2,1-2H3,(H,10,11)/b4-3+,7-5-.
What are the key properties of (2Z,4E)-7-methylocta-2,4-dienoic acid?
(2Z,4E)-7-methylocta-2,4-dienoic acid has a molecular weight of 154.21 g/mol, XLogP of 2.23, 4 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for (2Z,4E)-7-methylocta-2,4-dienoic acid is sourced from PubChem (CID 52940546), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).