C37H33ClF3NO5 — CID 52940614
17-methoxy-21-[(4-propan-2-ylphenyl)methyl]-16-[[4-(trifluoromethoxy)phenyl]methoxy]-5,7-dioxa-13-azoniapentacyclo[11.8.0.02,10.04,8.015,20]henicosa-1(13),2,4(8),9,14,16,18,20-octaene chloride (PubChem CID 52940614) has the molecular formula C37H33ClF3NO5 and a molecular weight of 664.12 g/mol. Its IUPAC name is 17-methoxy-21-[(4-propan-2-ylphenyl)methyl]-16-[[4-(trifluoromethoxy)phenyl]methoxy]-5,7-dioxa-13-azoniapentacyclo[11.8.0.02,10.04,8.015,20]henicosa-1(13),2,4(8),9,14,16,18,20-octaene chloride.
| Compound Name | 17-methoxy-21-[(4-propan-2-ylphenyl)methyl]-16-[[4-(trifluoromethoxy)phenyl]methoxy]-5,7-dioxa-13-azoniapentacyclo[11.8.0.02,10.04,8.015,20]henicosa-1(13),2,4(8),9,14,16,18,20-octaene chloride |
|---|---|
| PubChem CID | 52940614 |
| Molecular Formula | C37H33ClF3NO5 |
| Molecular Weight | 664.12 g/mol |
| Exact Mass | 663.20 |
| IUPAC Name | 17-methoxy-21-[(4-propan-2-ylphenyl)methyl]-16-[[4-(trifluoromethoxy)phenyl]methoxy]-5,7-dioxa-13-azoniapentacyclo[11.8.0.02,10.04,8.015,20]henicosa-1(13),2,4(8),9,14,16,18,20-octaene chloride |
| SMILES | COc1ccc2c(Cc3ccc(C(C)C)cc3)c3[n+](cc2c1OCc1ccc(OC(F)(F)F)cc1)CCc1cc2c(cc1-3)OCO2.[Cl-] |
| InChI | InChI=1S/C37H33F3NO5.ClH/c1-22(2)25-8-4-23(5-9-25)16-30-28-12-13-32(42-3)36(43-20-24-6-10-27(11-7-24)46-37(38,39)40)31(28)19-41-15-14-26-17-33-34(45-21-44-33)18-29(26)35(30)41;/h4-13,17-19,22H,14-16,20-21H2,1-3H3;1H/q+1;/p-1 |
| InChIKey | LZJRWOVNZCQDDI-UHFFFAOYSA-M |
| XLogP | 5.28 |
| TPSA | 50.03 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 47 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 664.12 |
| LogP ≤ 5 | 5.28 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|