C25H21N3O3 — CID 52940712
4-(dibenzylcarbamoyl)-2-phenyl-1H-imidazole-5-carboxylic acid (PubChem CID 52940712) has the molecular formula C25H21N3O3 and a molecular weight of 411.46 g/mol. Its IUPAC name is 4-(dibenzylcarbamoyl)-2-phenyl-1H-imidazole-5-carboxylic acid.
| Compound Name | 4-(dibenzylcarbamoyl)-2-phenyl-1H-imidazole-5-carboxylic acid |
|---|---|
| PubChem CID | 52940712 |
| Molecular Formula | C25H21N3O3 |
| Molecular Weight | 411.46 g/mol |
| Exact Mass | 411.16 |
| IUPAC Name | 4-(dibenzylcarbamoyl)-2-phenyl-1H-imidazole-5-carboxylic acid |
| SMILES | O=C(O)c1[nH]c(-c2ccccc2)nc1C(=O)N(Cc1ccccc1)Cc1ccccc1 |
| InChI | InChI=1S/C25H21N3O3/c29-24(21-22(25(30)31)27-23(26-21)20-14-8-3-9-15-20)28(16-18-10-4-1-5-11-18)17-19-12-6-2-7-13-19/h1-15H,16-17H2,(H,26,27)(H,30,31) |
| InChIKey | QLEMUSZICZCEGW-UHFFFAOYSA-N |
| XLogP | 4.62 |
| TPSA | 86.29 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 411.46 |
| LogP ≤ 5 | 4.62 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |