C27H43N5O5 — CID 52940769
benzyl N-[(2S)-4-methyl-1-[[1-[3-(4-methylpiperazin-1-yl)propylamino]-1,2-dioxopentan-3-yl]amino]-1-oxopentan-2-yl]carbamate (PubChem CID 52940769) has the molecular formula C27H43N5O5 and a molecular weight of 517.67 g/mol. Its IUPAC name is benzyl N-[(2S)-4-methyl-1-[[1-[3-(4-methylpiperazin-1-yl)propylamino]-1,2-dioxopentan-3-yl]amino]-1-oxopentan-2-yl]carbamate.
| Compound Name | benzyl N-[(2S)-4-methyl-1-[[1-[3-(4-methylpiperazin-1-yl)propylamino]-1,2-dioxopentan-3-yl]amino]-1-oxopentan-2-yl]carbamate |
|---|---|
| PubChem CID | 52940769 |
| Molecular Formula | C27H43N5O5 |
| Molecular Weight | 517.67 g/mol |
| Exact Mass | 517.33 |
| IUPAC Name | benzyl N-[(2S)-4-methyl-1-[[1-[3-(4-methylpiperazin-1-yl)propylamino]-1,2-dioxopentan-3-yl]amino]-1-oxopentan-2-yl]carbamate |
| SMILES | CCC(NC(=O)[C@H](CC(C)C)NC(=O)OCc1ccccc1)C(=O)C(=O)NCCCN1CCN(C)CC1 |
| InChI | InChI=1S/C27H43N5O5/c1-5-22(24(33)26(35)28-12-9-13-32-16-14-31(4)15-17-32)29-25(34)23(18-20(2)3)30-27(36)37-19-21-10-7-6-8-11-21/h6-8,10-11,20,22-23H,5,9,12-19H2,1-4H3,(H,28,35)(H,29,34)(H,30,36)/t22?,23-/m0/s1 |
| InChIKey | DPDSXVZBABJLPY-WCSIJFPASA-N |
| XLogP | 1.55 |
| TPSA | 120.08 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 517.67 |
| LogP ≤ 5 | 1.55 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|