About (6-oxo-5-phenyl-2,3-dihydropyran-3-yl)methyl acetate
(6-oxo-5-phenyl-2,3-dihydropyran-3-yl)methyl acetate (PubChem CID 52940781) has the molecular formula C14H14O4
and a molecular weight of 246.26 g/mol. Its IUPAC name is (6-oxo-5-phenyl-2,3-dihydropyran-3-yl)methyl acetate.
Molecular Properties
| Compound Name | (6-oxo-5-phenyl-2,3-dihydropyran-3-yl)methyl acetate |
| PubChem CID | 52940781 |
| Molecular Formula | C14H14O4 |
| Molecular Weight | 246.26 g/mol |
| Exact Mass | 246.09 |
| IUPAC Name | (6-oxo-5-phenyl-2,3-dihydropyran-3-yl)methyl acetate |
| SMILES | CC(=O)OCC1C=C(c2ccccc2)C(=O)OC1 |
| InChI | InChI=1S/C14H14O4/c1-10(15)17-8-11-7-13(14(16)18-9-11)12-5-3-2-4-6-12/h2-7,11H,8-9H2,1H3 |
| InChIKey | JPSCXGHJYWZKGU-UHFFFAOYSA-N |
| XLogP | 1.81 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 246.26 |
| LogP ≤ 5 | 1.81 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze (6-oxo-5-phenyl-2,3-dihydropyran-3-yl)methyl acetate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (6-oxo-5-phenyl-2,3-dihydropyran-3-yl)methyl acetate?
The IUPAC name of (6-oxo-5-phenyl-2,3-dihydropyran-3-yl)methyl acetate (CID 52940781) is (6-oxo-5-phenyl-2,3-dihydropyran-3-yl)methyl acetate.
What is the SMILES notation for (6-oxo-5-phenyl-2,3-dihydropyran-3-yl)methyl acetate?
The canonical SMILES for (6-oxo-5-phenyl-2,3-dihydropyran-3-yl)methyl acetate is CC(=O)OCC1C=C(c2ccccc2)C(=O)OC1.
What is the InChIKey of (6-oxo-5-phenyl-2,3-dihydropyran-3-yl)methyl acetate?
The InChIKey is JPSCXGHJYWZKGU-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H14O4/c1-10(15)17-8-11-7-13(14(16)18-9-11)12-5-3-2-4-6-12/h2-7,11H,8-9H2,1H3.
What are the key properties of (6-oxo-5-phenyl-2,3-dihydropyran-3-yl)methyl acetate?
(6-oxo-5-phenyl-2,3-dihydropyran-3-yl)methyl acetate has a molecular weight of 246.26 g/mol, XLogP of 1.81, 3 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for (6-oxo-5-phenyl-2,3-dihydropyran-3-yl)methyl acetate is sourced from PubChem (CID 52940781), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).