About N-(1,3-diphenylpyrazol-5-yl)-N'-methylpropanimidamide
N-(1,3-diphenylpyrazol-5-yl)-N'-methylpropanimidamide (PubChem CID 52940872) has the molecular formula C19H20N4
and a molecular weight of 304.40 g/mol. Its IUPAC name is N-(1,3-diphenylpyrazol-5-yl)-N'-methylpropanimidamide.
Molecular Properties
| Compound Name | N-(1,3-diphenylpyrazol-5-yl)-N'-methylpropanimidamide |
| PubChem CID | 52940872 |
| Molecular Formula | C19H20N4 |
| Molecular Weight | 304.40 g/mol |
| Exact Mass | 304.17 |
| IUPAC Name | N-(1,3-diphenylpyrazol-5-yl)-N'-methylpropanimidamide |
| SMILES | CC/C(=N\C)Nc1cc(-c2ccccc2)nn1-c1ccccc1 |
| InChI | InChI=1S/C19H20N4/c1-3-18(20-2)21-19-14-17(15-10-6-4-7-11-15)22-23(19)16-12-8-5-9-13-16/h4-14H,3H2,1-2H3,(H,20,21) |
| InChIKey | UGUCKYHPXPFIMG-UHFFFAOYSA-N |
| XLogP | 4.39 |
| TPSA | 42.21 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 304.40 |
| LogP ≤ 5 | 4.39 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|
Analyze N-(1,3-diphenylpyrazol-5-yl)-N'-methylpropanimidamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-(1,3-diphenylpyrazol-5-yl)-N'-methylpropanimidamide?
The IUPAC name of N-(1,3-diphenylpyrazol-5-yl)-N'-methylpropanimidamide (CID 52940872) is N-(1,3-diphenylpyrazol-5-yl)-N'-methylpropanimidamide.
What is the SMILES notation for N-(1,3-diphenylpyrazol-5-yl)-N'-methylpropanimidamide?
The canonical SMILES for N-(1,3-diphenylpyrazol-5-yl)-N'-methylpropanimidamide is CC/C(=N\C)Nc1cc(-c2ccccc2)nn1-c1ccccc1.
What is the InChIKey of N-(1,3-diphenylpyrazol-5-yl)-N'-methylpropanimidamide?
The InChIKey is UGUCKYHPXPFIMG-UHFFFAOYSA-N. The full InChI is InChI=1S/C19H20N4/c1-3-18(20-2)21-19-14-17(15-10-6-4-7-11-15)22-23(19)16-12-8-5-9-13-16/h4-14H,3H2,1-2H3,(H,20,21).
What are the key properties of N-(1,3-diphenylpyrazol-5-yl)-N'-methylpropanimidamide?
N-(1,3-diphenylpyrazol-5-yl)-N'-methylpropanimidamide has a molecular weight of 304.40 g/mol, XLogP of 4.39, 4 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for N-(1,3-diphenylpyrazol-5-yl)-N'-methylpropanimidamide is sourced from PubChem (CID 52940872), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).