C25H28N8O2 — CID 52940902
2-N-(3,5-dimorpholin-4-ylphenyl)-4-N-(1H-indazol-7-yl)pyrimidine-2,4-diamine (PubChem CID 52940902) has the molecular formula C25H28N8O2 and a molecular weight of 472.55 g/mol. Its IUPAC name is 2-N-(3,5-dimorpholin-4-ylphenyl)-4-N-(1H-indazol-7-yl)pyrimidine-2,4-diamine.
| Compound Name | 2-N-(3,5-dimorpholin-4-ylphenyl)-4-N-(1H-indazol-7-yl)pyrimidine-2,4-diamine |
|---|---|
| PubChem CID | 52940902 |
| Molecular Formula | C25H28N8O2 |
| Molecular Weight | 472.55 g/mol |
| Exact Mass | 472.23 |
| IUPAC Name | 2-N-(3,5-dimorpholin-4-ylphenyl)-4-N-(1H-indazol-7-yl)pyrimidine-2,4-diamine |
| SMILES | c1cc(Nc2ccnc(Nc3cc(N4CCOCC4)cc(N4CCOCC4)c3)n2)c2[nH]ncc2c1 |
| InChI | InChI=1S/C25H28N8O2/c1-2-18-17-27-31-24(18)22(3-1)29-23-4-5-26-25(30-23)28-19-14-20(32-6-10-34-11-7-32)16-21(15-19)33-8-12-35-13-9-33/h1-5,14-17H,6-13H2,(H,27,31)(H2,26,28,29,30) |
| InChIKey | PDKQWKZLHGNIBX-UHFFFAOYSA-N |
| XLogP | 3.51 |
| TPSA | 103.46 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 472.55 |
| LogP ≤ 5 | 3.51 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |