About N'-(1,3-diphenylpyrazol-5-yl)-N,N-dimethylethanimidamide
N'-(1,3-diphenylpyrazol-5-yl)-N,N-dimethylethanimidamide (PubChem CID 52940944) has the molecular formula C19H20N4
and a molecular weight of 304.40 g/mol. Its IUPAC name is N'-(1,3-diphenylpyrazol-5-yl)-N,N-dimethylethanimidamide.
Molecular Properties
| Compound Name | N'-(1,3-diphenylpyrazol-5-yl)-N,N-dimethylethanimidamide |
| PubChem CID | 52940944 |
| Molecular Formula | C19H20N4 |
| Molecular Weight | 304.40 g/mol |
| Exact Mass | 304.17 |
| IUPAC Name | N'-(1,3-diphenylpyrazol-5-yl)-N,N-dimethylethanimidamide |
| SMILES | C/C(=N\c1cc(-c2ccccc2)nn1-c1ccccc1)N(C)C |
| InChI | InChI=1S/C19H20N4/c1-15(22(2)3)20-19-14-18(16-10-6-4-7-11-16)21-23(19)17-12-8-5-9-13-17/h4-14H,1-3H3/b20-15+ |
| InChIKey | ZRJAGZWORDHXMZ-HMMYKYKNSA-N |
| XLogP | 4.15 |
| TPSA | 33.42 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 304.40 |
| LogP ≤ 5 | 4.15 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|
Analyze N'-(1,3-diphenylpyrazol-5-yl)-N,N-dimethylethanimidamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N'-(1,3-diphenylpyrazol-5-yl)-N,N-dimethylethanimidamide?
The IUPAC name of N'-(1,3-diphenylpyrazol-5-yl)-N,N-dimethylethanimidamide (CID 52940944) is N'-(1,3-diphenylpyrazol-5-yl)-N,N-dimethylethanimidamide.
What is the SMILES notation for N'-(1,3-diphenylpyrazol-5-yl)-N,N-dimethylethanimidamide?
The canonical SMILES for N'-(1,3-diphenylpyrazol-5-yl)-N,N-dimethylethanimidamide is C/C(=N\c1cc(-c2ccccc2)nn1-c1ccccc1)N(C)C.
What is the InChIKey of N'-(1,3-diphenylpyrazol-5-yl)-N,N-dimethylethanimidamide?
The InChIKey is ZRJAGZWORDHXMZ-HMMYKYKNSA-N. The full InChI is InChI=1S/C19H20N4/c1-15(22(2)3)20-19-14-18(16-10-6-4-7-11-16)21-23(19)17-12-8-5-9-13-17/h4-14H,1-3H3/b20-15+.
What are the key properties of N'-(1,3-diphenylpyrazol-5-yl)-N,N-dimethylethanimidamide?
N'-(1,3-diphenylpyrazol-5-yl)-N,N-dimethylethanimidamide has a molecular weight of 304.40 g/mol, XLogP of 4.15, 3 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for N'-(1,3-diphenylpyrazol-5-yl)-N,N-dimethylethanimidamide is sourced from PubChem (CID 52940944), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).