C14H20N6S2 — CID 52940983
3-butylsulfanyl-5-(3-butylsulfanyl-1,2,4-triazin-5-yl)-1,2,4-triazine (PubChem CID 52940983) has the molecular formula C14H20N6S2 and a molecular weight of 336.49 g/mol. Its IUPAC name is 3-butylsulfanyl-5-(3-butylsulfanyl-1,2,4-triazin-5-yl)-1,2,4-triazine.
| Compound Name | 3-butylsulfanyl-5-(3-butylsulfanyl-1,2,4-triazin-5-yl)-1,2,4-triazine |
|---|---|
| PubChem CID | 52940983 |
| Molecular Formula | C14H20N6S2 |
| Molecular Weight | 336.49 g/mol |
| Exact Mass | 336.12 |
| IUPAC Name | 3-butylsulfanyl-5-(3-butylsulfanyl-1,2,4-triazin-5-yl)-1,2,4-triazine |
| SMILES | CCCCSc1nncc(-c2cnnc(SCCCC)n2)n1 |
| InChI | InChI=1S/C14H20N6S2/c1-3-5-7-21-13-17-11(9-15-19-13)12-10-16-20-14(18-12)22-8-6-4-2/h9-10H,3-8H2,1-2H3 |
| InChIKey | WFSQPEIEWUHMFA-UHFFFAOYSA-N |
| XLogP | 3.51 |
| TPSA | 77.34 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 336.49 |
| LogP ≤ 5 | 3.51 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|