C22H28O5 — CID 52941017
[(1S,4S,5S,10S,12R,14S)-5-methyl-16-methylidene-8,15-dioxo-4-prop-1-en-2-yl-9-oxatetracyclo[10.2.2.01,10.05,10]hexadecan-14-yl] acetate (PubChem CID 52941017) has the molecular formula C22H28O5 and a molecular weight of 372.46 g/mol. Its IUPAC name is [(1S,4S,5S,10S,12R,14S)-5-methyl-16-methylidene-8,15-dioxo-4-prop-1-en-2-yl-9-oxatetracyclo[10.2.2.01,10.05,10]hexadecan-14-yl] acetate.
| Compound Name | [(1S,4S,5S,10S,12R,14S)-5-methyl-16-methylidene-8,15-dioxo-4-prop-1-en-2-yl-9-oxatetracyclo[10.2.2.01,10.05,10]hexadecan-14-yl] acetate |
|---|---|
| PubChem CID | 52941017 |
| Molecular Formula | C22H28O5 |
| Molecular Weight | 372.46 g/mol |
| Exact Mass | 372.19 |
| IUPAC Name | [(1S,4S,5S,10S,12R,14S)-5-methyl-16-methylidene-8,15-dioxo-4-prop-1-en-2-yl-9-oxatetracyclo[10.2.2.01,10.05,10]hexadecan-14-yl] acetate |
| SMILES | C=C1C(=O)[C@]23CC[C@@H](C(=C)C)[C@]4(C)CCC(=O)O[C@@]42C[C@H]1C[C@@H]3OC(C)=O |
| InChI | InChI=1S/C22H28O5/c1-12(2)16-6-9-21-17(26-14(4)23)10-15(13(3)19(21)25)11-22(21)20(16,5)8-7-18(24)27-22/h15-17H,1,3,6-11H2,2,4-5H3/t15-,16+,17+,20+,21-,22+/m1/s1 |
| InChIKey | GTSBYDSLDSOPCU-RUNIHDHWSA-N |
| XLogP | 3.52 |
| TPSA | 69.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 372.46 |
| LogP ≤ 5 | 3.52 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|