C19H18N6O — CID 52941019
[3-[[4-[1H-indazol-4-yl(methyl)amino]pyrimidin-2-yl]amino]phenyl]methanol (PubChem CID 52941019) has the molecular formula C19H18N6O and a molecular weight of 346.39 g/mol. Its IUPAC name is [3-[[4-[1H-indazol-4-yl(methyl)amino]pyrimidin-2-yl]amino]phenyl]methanol.
| Compound Name | [3-[[4-[1H-indazol-4-yl(methyl)amino]pyrimidin-2-yl]amino]phenyl]methanol |
|---|---|
| PubChem CID | 52941019 |
| Molecular Formula | C19H18N6O |
| Molecular Weight | 346.39 g/mol |
| Exact Mass | 346.15 |
| IUPAC Name | [3-[[4-[1H-indazol-4-yl(methyl)amino]pyrimidin-2-yl]amino]phenyl]methanol |
| SMILES | CN(c1ccnc(Nc2cccc(CO)c2)n1)c1cccc2[nH]ncc12 |
| InChI | InChI=1S/C19H18N6O/c1-25(17-7-3-6-16-15(17)11-21-24-16)18-8-9-20-19(23-18)22-14-5-2-4-13(10-14)12-26/h2-11,26H,12H2,1H3,(H,21,24)(H,20,22,23) |
| InChIKey | KFNNEFIVNZLLBN-UHFFFAOYSA-N |
| XLogP | 3.36 |
| TPSA | 89.96 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 346.39 |
| LogP ≤ 5 | 3.36 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |